| Drug General Information |
| Drug ID |
D0G7NW
|
| Former ID |
DIB019672
|
| Drug Name |
cyamemazine
|
| Synonyms |
cyamepromazine; RP-7204
|
| Drug Type |
Small molecular drug
|
| Formula |
C19H21N3S
|
| InChI |
InChI=1S/C19H21N3S/c1-14(12-21(2)3)13-22-16-6-4-5-7-18(16)23-19-9-8-15(11-20)10-17(19)22/h4-10,14H,12-13H2,1-3H3
|
| InChIKey |
SLFGIOIONGJGRT-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
8188334, 14826280, 43119930, 47285901, 47880135, 50006264, 51091644, 57314886, 75129996, 85209840, 96099841, 104326854, 125824719, 135019180, 135650143, 136158994, 136352157, 137006389, 142677092, 160676424, 162221098, 163133724, 164838618, 164838619, 172919690, 179225635, 184530546, 226509842, 249924678
|
| Target and Pathway |
| References |