| Drug General Information |
| Drug ID |
D0Q0MM
|
| Former ID |
DNC000883
|
| Drug Name |
L-NG-nitroarginine methyl ester
|
| Drug Type |
Small molecular drug
|
| Formula |
C14H8O6
|
| Canonical SMILES |
C1=CC(=C(C2=C1C(=O)C3=C(C=CC(=C3C2=O)O)O)O)O
|
| InChI |
1S/C14H8O6/c15-6-3-4-7(16)11-10(6)12(18)5-1-2-8(17)13(19)9(5)14(11)20/h1-4,15-17,19H
|
| InChIKey |
VBHKTXLEJZIDJF-UHFFFAOYSA-N
|
| CAS Number |
CAS 81-61-8
|
| PubChem Compound ID |
|
| PubChem Substance ID |
538929, 559520, 597172, 3136041, 3293300, 5198884, 8137849, 8149661, 8153081, 10536453, 11335319, 11360558, 11363846, 11366408, 11368970, 11371776, 11374573, 11377132, 11408566, 11461530, 11485020, 11489178, 11490594, 11492812, 11494766, 12159155, 15197433, 17487280, 25621969, 26612059, 26679922, 26749241, 26749242, 29224076, 47291001, 47810609, 47810610, 49870672, 50107550, 57322564, 80360051, 85149392, 85280609, 85286145, 89174979, 92124943, 96107656, 99301232, 99445131, 103198778
|
| ChEBI ID |
ChEBI:37495
|
| Target and Pathway |
| References |