| Drug General Information |
| Drug ID |
D0N1FS
|
| Former ID |
DNC000544
|
| Drug Name |
Diacerein
|
| Drug Type |
Small molecular drug
|
| Formula |
C19H12O8
|
| Canonical SMILES |
CC(=O)OC1=CC=CC2=C1C(=O)C3=C(C=C(C=C3C2=O)C(=O)O)OC(=O)<br />C
|
| InChI |
1S/C19H12O8/c1-8(20)26-13-5-3-4-11-15(13)18(23)16-12(17(11)22)6-10(19(24)25)7-14(16)27-9(2)21/h3-7H,1-2H3,(H,24,25)
|
| InChIKey |
TYNLGDBUJLVSMA-UHFFFAOYSA-N
|
| CAS Number |
CAS 13739-02-1
|
| PubChem Compound ID |
|
| PubChem Substance ID |
855680, 4363810, 8169045, 11341914, 11362097, 11364807, 11367369, 11369931, 11372073, 11374729, 11378098, 11484481, 11487499, 11488639, 11490752, 11492850, 11495690, 12012675, 14901773, 24894281, 26612251, 26680442, 26746957, 28325764, 29293111, 47942826, 49830871, 49870698, 50100992, 51091608, 57310202, 76715691, 80030301, 81041119, 85279713, 91011503, 103220500, 104171387, 104296775, 117575544, 117689433, 124638102, 124883601, 124883602, 125325747, 125340536, 126592381, 126666939, 129332407, 131298280
|
| SuperDrug ATC ID |
M01AX21
|
| SuperDrug CAS ID |
cas=013739021
|
| Target and Pathway |
| References |