| Drug General Information |
| Drug ID |
D0GH2C
|
| Former ID |
DCL001005
|
| Drug Name |
Sulfasalizine
|
| Drug Type |
Small molecular drug
|
| Company |
Pfizer
|
| Formula |
C18H14N4O5S
|
| Canonical SMILES |
C1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)NN=C3C=CC(=O)C(=C3)<br />C(=O)O
|
| InChI |
1S/C18H14N4O5S/c23-16-9-6-13(11-15(16)18(24)25)21-20-12-4-7-14(8-5-12)28(26,27)22-17-3-1-2-10-19-17/h1-11,20H,(H,19,22)(H,24,25)/b21-13-
|
| InChIKey |
OQANPHBRHBJGNZ-BKUYFWCQSA-N
|
| CAS Number |
CAS 599-79-1
|
| PubChem Compound ID |
|
| PubChem Substance ID |
9524, 452205, 7847514, 7890377, 10321791, 11112423, 17389737, 26747277, 26747278, 39383787, 46391376, 46505451, 48414442, 48416584, 48424062, 48425604, 49698537, 50105482, 50105483, 53789773, 57361929, 78341122, 85147460, 85164696, 85174423, 85787939, 87560165, 92125445, 93166319, 103914276, 103994509, 104134816, 114147521, 117607242, 124890162, 124890163, 134337474, 134339436, 134976371, 135692179, 139618183, 144204588, 144208437, 144210859, 160964137, 164788662, 170464716, 172386498, 175267319, 179038496
|
| ChEBI ID |
ChEBI:9334
|
| SuperDrug ATC ID |
A07EC01
|
| SuperDrug CAS ID |
cas=000599791
|
| Target and Pathway |
| References |