| Drug General Information |
| Drug ID |
D0E9VU
|
| Former ID |
DNC012645
|
| Drug Name |
LEVONORDEFRIN
|
| Drug Type |
Small molecular drug
|
| Formula |
C9H13NO3
|
| InChI |
InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1
|
| InChIKey |
GEFQWZLICWMTKF-CDUCUWFYSA-N
|
| CAS Number |
CAS 829-74-3
|
| PubChem Compound ID |
|
| PubChem Substance ID |
13932, 7849447, 8149401, 10255593, 11111073, 11112447, 11335490, 11360729, 11364536, 11367098, 11369660, 11371540, 11373602, 11377822, 11461701, 11484746, 11488871, 11490296, 11491847, 11495456, 15947283, 24277784, 26611796, 26679431, 46238888, 47216686, 47365101, 47885314, 48110365, 48334396, 48334397, 48479897, 49699157, 50065272, 50100443, 50100444, 57350546, 57654107, 79290449, 92124111, 92307503, 99301403, 99443259, 103190505, 103938162, 113454748, 121363335, 124550756, 124637940, 124882389
|
| Target and Pathway |
| References |