| Drug General Information |
| Drug ID |
D0B3FV
|
| Former ID |
DCL000902
|
| Drug Name |
NVP-LAQ824
|
| Synonyms |
Dacinostat; LAQ-824; NVP-LAQ 824; NVP-LAQ824, Dacinostat, LAQ824; (2E)-N-hydroxy-3-[4-({(2-hydroxyethyl)[2-(1H-indol-3-yl)ethyl]amino}methyl)phenyl]prop-2-enamide; (E)-N-hydroxy-3-[4-[[2-hydroxyethyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]phenyl]prop-2-enamide
|
| Drug Type |
Small molecular drug
|
| Company |
Corcept Therapeutics
|
| Formula |
C22H25N3O3
|
| Canonical SMILES |
C1=CC=C2C(=C1)C(=CN2)CCN(CCO)CC3=CC=C(C=C3)C=CC(=O)NO
|
| InChI |
1S/C22H25N3O3/c26-14-13-25(12-11-19-15-23-21-4-2-1-3-20(19)21)16-18-7-5-17(6-8-18)9-10-22(27)24-28/h1-10,15,23,26,28H,11-14,16H2,(H,24,27)/b10-9+
|
| InChIKey |
BWDQBBCUWLSASG-MDZDMXLPSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
11969807, 14877864, 43037729, 46519450, 50075745, 53260712, 53788896, 56314024, 57369859, 87226484, 99375472, 99430921, 99436979, 103381801, 114573086, 124756994, 125163799, 126671546, 127342238, 127342239, 131313854, 131480755, 134339354, 134340172, 134964541, 135135691, 135357949, 136367294, 136920345, 137053873, 140114881, 144116128, 152039207, 152344356, 162037430, 162202709, 162202786, 164193981, 172821429, 175608164, 180371815, 186024308, 187051799, 188899511, 198961127, 210274900, 210280535, 223669689, 223704892, 223705151
|
| ChEBI ID |
ChEBI:50692
|
| SuperDrug ATC ID |
G03XB01
|
| SuperDrug CAS ID |
cas=084371653
|
| Target and Pathway |
| References |