| Drug General Information |
| Drug ID |
D07SFI
|
| Former ID |
DNC002790
|
| Drug Name |
Benzamidine
|
| Drug Type |
Small molecular drug
|
| Formula |
C7H8N2
|
| InChI |
InChI=1S/C7H8N2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H3,8,9)
|
| InChIKey |
PXXJHWLDUBFPOL-UHFFFAOYSA-N
|
| CAS Number |
CAS 618-39-3
|
| PubChem Compound ID |
|
| PubChem Substance ID |
4914, 135465, 584670, 584740, 584927, 585322, 607907, 821862, 823141, 823142, 823143, 823277, 823352, 825339, 825834, 825895, 825920, 826476, 827700, 828937, 832980, 833678, 833680, 833687, 833701, 833703, 833704, 833710, 833712, 833713, 834934, 835099, 835723, 835724, 835756, 837596, 838133, 838820, 841994, 3132054, 4572618, 7886117, 7886139, 7979569, 8020719, 8025546, 8025549, 8025553, 8026736, 8026936
|
| Target and Pathway |
| References |