| Drug General Information |
| Drug ID |
D06KNK
|
| Former ID |
DIB019956
|
| Drug Name |
TDZD-8
|
| Synonyms |
TDZD-8
|
| Drug Type |
Small molecular drug
|
| Formula |
C10H10N2O2S
|
| InChI |
InChI=1S/C10H10N2O2S/c1-11-9(13)12(10(14)15-11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3
|
| InChIKey |
JDSJDASOXWCHPN-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
6055436, 8356425, 11108555, 14797987, 26758797, 29217671, 35381791, 47720585, 57356766, 58107448, 76462416, 91610839, 92708299, 99302711, 103192812, 112676838, 124893197, 125580415, 126590965, 134223934, 137232094, 137650937, 152254773, 160833940, 162009856, 162011986, 162248544, 162837469, 163395753, 163688046, 163779005, 163843565, 164836458, 174528910, 175607478, 178102600, 179236131, 184600769, 186014480, 187561549, 202551613, 204394183, 210274741, 210280374, 223366708, 223379791, 223454879, 223519410, 226506996, 242060039
|
| Target and Pathway |
| References |