| Drug General Information |
| Drug ID |
D00ZAJ
|
| Former ID |
DNC002520
|
| Drug Name |
2-AMINO-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE
|
| Drug Type |
Small molecular drug
|
| Formula |
C13H12N4
|
| Canonical SMILES |
CN1C2=C(N=CC(=C2)C3=CC=CC=C3)N=C1N
|
| InChI |
1S/C13H12N4/c1-17-11-7-10(9-5-3-2-4-6-9)8-15-12(11)16-13(17)14/h2-8H,1H3,(H2,14,15,16)
|
| InChIKey |
UQVKZNNCIHJZLS-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
3157795, 5575539, 7889895, 8151167, 14773663, 24439858, 26706921, 47205348, 47213254, 49655368, 49981200, 50077334, 53790715, 56311095, 57320930, 69519515, 75586395, 84933929, 85083684, 88802108, 99444869, 103101540, 104239441, 104297984, 117521388, 125362482, 129407608, 135020564, 137009621, 144233754, 160969439, 162127724, 162271907, 162476045, 164223590, 164796165, 164835618, 170474404, 174558552, 184564905, 198966617, 202556526, 204414277, 215774860, 223515797, 223541200, 226516667, 249790662, 252330901
|
| Target and Pathway |
| References |