| Drug General Information |
| Drug ID |
D0W8XH
|
| Former ID |
DNC002358
|
| Drug Name |
PI-103
|
| Drug Type |
Small molecular drug
|
| Therapeutic Class |
Anticancer Agents
|
| Formula |
C19H16N4O3
|
| InChI |
InChI=1S/C19H16N4O3/c24-13-4-1-3-12(11-13)17-21-15-14-5-2-6-20-19(14)26-16(15)18(22-17)23-7-9-25-10-8-23/h1-6,11,24H,7-10H2
|
| InChIKey |
TUVCWJQQGGETHL-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
14851847, 24171563, 26746641, 26759370, 45631627, 50100110, 53799218, 53800591, 56374189, 57373674, 71825407, 78998392, 92093191, 99302652, 99436951, 103694308, 103905507, 124659188, 124756953, 124898780, 124898781, 125163759, 125335464, 131465116, 134223008, 134964219, 135631956, 135685224, 135685225, 135685244, 136340108, 136367820, 136920407, 137275834, 141775457, 152258089, 160646928, 162011356, 162037397, 162169833, 162202614, 163125995, 163687483, 163893470, 164045350, 170481595, 171062264, 172650032, 172914365, 174561060
|
| Target and Pathway |
| References |