| Drug General Information |
| Drug ID |
D0V3SO
|
| Former ID |
DNC002853
|
| Drug Name |
5-(1,4-DIAZEPAN-1-SULFONYL)ISOQUINOLINE
|
| Drug Type |
Small molecular drug
|
| Formula |
C14H17N3O2S
|
| Canonical SMILES |
C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3
|
| InChI |
1S/C14H17N3O2S/c18-20(19,17-9-2-6-15-8-10-17)14-4-1-3-12-11-16-7-5-13(12)14/h1,3-5,7,11,15H,2,6,8-10H2
|
| InChIKey |
NGOGFTYYXHNFQH-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
645246, 830160, 841200, 7411211, 7888736, 8152246, 11113364, 11121731, 11122211, 11362865, 11365427, 11367989, 11370941, 11370942, 11373590, 11376151, 14849184, 26751605, 26751606, 29222678, 46392968, 46394056, 46394198, 46514392, 47810568, 47959546, 48034909, 48110269, 48184808, 49961274, 50100814, 50871527, 53790340, 57321867, 81062559, 85787246, 85787262, 91614085, 92251456, 92308789, 92310082, 92708292, 93577882, 96024636, 99300994, 99302514, 99444633, 103064513, 103083244, 103210437
|
| Target and Pathway |
| References |