| Drug General Information |
| Drug ID |
D0UT7X
|
| Former ID |
DIB018033
|
| Drug Name |
tideglusib
|
| Synonyms |
NP031112
|
| Drug Type |
Small molecular drug
|
| Formula |
C19H14N2O2S
|
| InChI |
InChI=1S/C19H14N2O2S/c22-18-20(13-14-7-2-1-3-8-14)19(23)24-21(18)17-12-6-10-15-9-4-5-11-16(15)17/h1-12H,13H2
|
| InChIKey |
PMJIHLSCWIDGMD-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
16402803, 23479335, 42392978, 77497949, 135302775, 135311466, 137549804, 152159707, 152255041, 152258612, 160647447, 162012014, 172919715, 174531064, 178103511, 186014846, 189253889, 196409730, 198979629, 226972235, 242060054, 244837723, 252451081, 252552511, 252671599
|
| Target and Pathway |
| References |