| Drug General Information |
| Drug ID |
D0U3WQ
|
| Former ID |
DIB018776
|
| Drug Name |
AGL 2043
|
| Synonyms |
AGL-2043; HMS3229A05; AGL2043
|
| Drug Type |
Small molecular drug
|
| Formula |
C15H12N4S
|
| InChI |
InChI=1S/C15H12N4S/c1-9-17-12-6-11-10(7-14(12)19(9)2)16-8-13(18-11)15-4-3-5-20-15/h3-8H,1-2H3
|
| InChIKey |
ZGDACLBJJXLKJY-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
14775296, 24121527, 26758177, 44853130, 47943735, 77674142, 99302611, 121380097, 141995359, 163132525, 163315706, 163688651, 172649782, 175607386, 178102541, 198983575, 227116437, 244346939, 249776632
|
| Target and Pathway |
| References |