| Drug General Information |
| Drug ID |
D0T8KR
|
| Former ID |
DNC014447
|
| Drug Name |
TWS-119
|
| Drug Type |
Small molecular drug
|
| Formula |
C18H14N4O2
|
| InChI |
InChI=1S/C18H14N4O2/c19-12-4-1-3-11(7-12)16-9-15-17(22-16)20-10-21-18(15)24-14-6-2-5-13(23)8-14/h1-10,23H,19H2,(H,20,21,22)
|
| InChIKey |
VPVLEBIVXZSOMQ-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
14720344, 14776903, 23984865, 26758807, 44692618, 48020050, 53800752, 80348364, 85787226, 91136600, 99302806, 103567441, 104253237, 123105101, 125335707, 134351652, 134964443, 136348261, 136367556, 136367744, 139797663, 152258259, 152344232, 160647095, 162011851, 162038068, 162202791, 163125997, 163688036, 165247649, 170497643, 170500656, 172919793, 174006978, 174529960, 175607483, 178102603, 179230462, 186005333, 204371598, 208264968, 218926473, 223399381, 223705086, 223925632, 231373952, 242060077, 244956719, 247953237, 249755532
|
| Target and Pathway |
| References |