| Drug General Information |
| Drug ID |
D0R7BX
|
| Former ID |
DNC002776
|
| Drug Name |
RU78191
|
| Drug Type |
Small molecular drug
|
| Formula |
C9H8O4
|
| Canonical SMILES |
C1=CC=C(C=C1)C(C(=O)O)C(=O)O
|
| InChI |
1S/C9H8O4/c10-8(11)7(9(12)13)6-4-2-1-3-5-6/h1-5,7H,(H,10,11)(H,12,13)
|
| InChIKey |
WWYDYZMNFQIYPT-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
87767, 96474, 828235, 3136926, 6788698, 7885491, 8197532, 14891843, 24849865, 43131518, 46392739, 46507607, 46515007, 50747150, 56370581, 57319807, 87575101, 90440521, 92251022, 92710699, 97302051, 103279306, 103844837, 104362596, 114917643, 117542833, 117687076, 118312758, 124441657, 125346385, 126631610, 129646315, 135033648, 135563036, 136274444, 137021714, 142478305, 143438061, 144022060, 144180056, 160793392, 160871760, 160967142, 162175319, 162278695, 162758047, 163414974, 163782876, 164831551, 165398543
|
| Target and Pathway |
| References |