| Drug General Information |
| Drug ID |
D0N1BU
|
| Former ID |
DCL001189
|
| Drug Name |
GDC-0980
|
| Drug Type |
Small molecular drug
|
| Company |
Genentech; Piramed - Hoffmann-La Roche
|
| Formula |
C23H30N8O3S
|
| Canonical SMILES |
CC1=C(SC2=C1N=C(N=C2N3CCOCC3)C4=CN=C(N=C4)N)CN5CCN(CC5)<br />C(=O)C(C)O
|
| InChI |
1S/C23H30N8O3S/c1-14-17(13-29-3-5-31(6-4-29)22(33)15(2)32)35-19-18(14)27-20(16-11-25-23(24)26-12-16)28-21(19)30-7-9-34-10-8-30/h11-12,15,32H,3-10,13H2,1-2H3,(H2,24,25,26)/t15-/m0/s1
|
| InChIKey |
YOVVNQKCSKSHKT-HNNXBMFYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
58088126, 85071230, 126497218, 136340124, 136349560, 136367691, 136920331, 136936437, 136962228, 141811291, 143499857, 144116008, 152233031, 152255050, 152255768, 152258485, 160647320, 160657174, 162011357, 162038118, 162202638, 163643094, 164045108, 174525857, 184816736, 189622848, 198974042, 223377949, 224209864, 226784456, 242772564, 249565579, 252109872, 252160446, 252451804, 252543421
|
| Target and Pathway |
| References |