| Drug General Information |
| Drug ID |
D0M4BJ
|
| Former ID |
DNC011163
|
| Drug Name |
AS-605240
|
| Drug Type |
Small molecular drug
|
| Formula |
C12H7N3O2S
|
| InChI |
InChI=1S/C12H7N3O2S/c16-11-10(18-12(17)15-11)6-7-1-2-8-9(5-7)14-4-3-13-8/h1-6H,(H,15,16,17)/b10-6-
|
| InChIKey |
SQWZFLMPDUSYGV-POHAHGRESA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
7890172, 8026294, 11041534, 16594487, 26759372, 39321480, 46393784, 46508826, 53685194, 90341202, 99302749, 99437139, 103703191, 113873891, 117646056, 121361720, 123121568, 124659187, 124757232, 125164036, 131480870, 134348368, 135631953, 136340111, 136367417, 136920267, 137183494, 141309610, 144115628, 152258085, 152344517, 160646924, 160967747, 162011467, 162146677, 163564901, 163687481, 177748759, 178102645, 186014811, 204380104, 226965556, 241376531, 252157372, 252450598, 252457912
|
| Target and Pathway |
| References |