| Drug General Information |
| Drug ID |
D0C3ZR
|
| Former ID |
DCL000246
|
| Drug Name |
TG100-115
|
| Synonyms |
TG-100115; TG-100-115; TG100115, TG100-115; 3,3'-(2,4-diaminopteridine-6,7-diyl)diphenol; 3-(2,4-diamino-6-(3-hydroxyphenyl)pteridin-7-yl)phenol; 3-[2,4-diamino-7-(3-hydroxyphenyl)pteridin-6-yl]phenol
|
| Drug Type |
Small molecular drug
|
| Company |
TargeGen
|
| Formula |
C18H14N6O2
|
| InChI |
InChI=1S/C18H14N6O2/c19-16-15-17(24-18(20)23-16)22-14(10-4-2-6-12(26)8-10)13(21-15)9-3-1-5-11(25)7-9/h1-8,25-26H,(H4,19,20,22,23,24)
|
| InChIKey |
UJIAQDJKSXQLIT-UHFFFAOYSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
15447068, 22769253, 40555380, 56374226, 77520336, 87550994, 87692392, 93581263, 99437104, 103526391, 124757182, 125163986, 125568862, 126731485, 131480851, 134338906, 136340114, 136367398, 136367762, 139630620, 152258087, 152344030, 160646926, 162011833, 162037556, 162202597, 162628940, 172650249, 172919686, 174006467, 174561103, 177748756, 178102341, 180189211, 186014830, 188899570, 198958964, 202556337, 223400365, 223678544, 223705052, 223895079, 226693154, 242060047, 245512251, 251971175, 252216453, 252451592, 252543376
|
| Target and Pathway |
| References |