| Drug General Information |
| Drug ID |
D07XCA
|
| Former ID |
DNC004145
|
| Drug Name |
A-286982
|
| Drug Type |
Small molecular drug
|
| Formula |
C24H27N3O4S
|
| InChI |
InChI=1S/C24H27N3O4S/c1-17(2)20-6-4-5-7-22(20)32-23-10-8-19(16-21(23)27(30)31)9-11-24(29)26-14-12-25(13-15-26)18(3)28/h4-11,16-17H,12-15H2,1-3H3/b11-9+
|
| InChIKey |
HTGGAYLWTDOFDK-PKNBQFBNSA-N
|
| PubChem Compound ID |
|
| PubChem Substance ID |
14808739, 24143718, 44944797, 80122047, 103185178, 103990982, 134341350, 139426368, 172649889, 178103205, 196372069, 198987132, 231615185, 237179908, 241376877, 249618116, 252157890, 252450272, 252543549
|
| Target and Pathway |
| References |