| Drug General Information |
| Drug ID |
D03NEO
|
| Former ID |
DNC003201
|
| Drug Name |
Isatin
|
| Drug Type |
Small molecular drug
|
| Formula |
C8H5NO2
|
| Canonical SMILES |
C1=CC=C2C(=C1)C(=O)C(=O)N2
|
| InChI |
1S/C8H5NO2/c10-7-5-3-1-2-4-6(5)9-8(7)11/h1-4H,(H,9,10,11)
|
| InChIKey |
JXDYKVIHCLTXOP-UHFFFAOYSA-N
|
| CAS Number |
CAS 91-56-5
|
| PubChem Compound ID |
|
| PubChem Substance ID |
13311, 74778, 588067, 609442, 828715, 854732, 3135354, 6540098, 7888476, 8144494, 8154653, 10318989, 10537814, 15165149, 24847187, 24881078, 29225963, 39219413, 46507369, 46509351, 47193744, 49747868, 49984034, 50444233, 53789500, 53795737, 56311817, 56368995, 57244143, 57323917, 57389141, 58024311, 70505287, 85087032, 85247250, 87571483, 88519211, 92710096, 99368072, 103345075, 104313837, 104667548, 117594108, 117689227, 118052844, 121281488, 124811779, 124953324, 125002090, 125359687
|
| Target and Pathway |
| References |